1-(2-Fluorophenyl)cyclobutanamine - CAS 1017391-62-6
Catalog: |
BB000630 |
Product Name: |
1-(2-Fluorophenyl)cyclobutanamine |
CAS: |
1017391-62-6 |
Synonyms: |
1-(2-fluorophenyl)-1-cyclobutanamine; 1-(2-fluorophenyl)cyclobutan-1-amine |
IUPAC Name: | 1-(2-fluorophenyl)cyclobutan-1-amine |
Description: | 1-(2-Fluorophenyl)cyclobutanamine (CAS# 1017391-62-6 ) is a useful research chemical. |
Molecular Weight: | 165.21 |
Molecular Formula: | C10H12FN |
Canonical SMILES: | C1CC(C1)(C2=CC=CC=C2F)N |
InChI: | InChI=1S/C10H12FN/c11-9-5-2-1-4-8(9)10(12)6-3-7-10/h1-2,4-5H,3,6-7,12H2 |
InChI Key: | AXNNZTURGGNMJF-UHFFFAOYSA-N |
LogP: | 2.86390 |
Publication Number | Title | Priority Date |
US-2020078358-A1 | Compounds and Methods for Treatment of Visceral Pain | 20170508 |
AU-2017371674-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
BR-112019011121-A2 | benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
CA-3042004-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
EP-3551626-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 165.095377549 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 165.095377549 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS