1-(2-Chlorophenyl)cyclobutanamine - CAS 1228994-80-6
Catalog: |
BB005599 |
Product Name: |
1-(2-Chlorophenyl)cyclobutanamine |
CAS: |
1228994-80-6 |
Synonyms: |
1-(2-chlorophenyl)-1-cyclobutanamine; 1-(2-chlorophenyl)cyclobutan-1-amine |
IUPAC Name: | 1-(2-chlorophenyl)cyclobutan-1-amine |
Description: | 1-(2-Chlorophenyl)cyclobutanamine (CAS# 1228994-80-6 ) is a useful research chemical. |
Molecular Weight: | 181.66 |
Molecular Formula: | C10H12ClN |
Canonical SMILES: | C1CC(C1)(C2=CC=CC=C2Cl)N |
InChI: | InChI=1S/C10H12ClN/c11-9-5-2-1-4-8(9)10(12)6-3-7-10/h1-2,4-5H,3,6-7,12H2 |
InChI Key: | BUQNXOFUXDRKGQ-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
RU-2695133-C1 | Oxadiazolamine derivatives as histone deacetylase 6 inhibitor and pharmaceutical composition containing them | 20151012 |
TW-201716397-A | An oxazolamide derivative as a histone deacetylase 6 inhibitor and a pharmaceutical composition containing the same | 20151012 |
US-10494355-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 181.0658271 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 181.0658271 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS