1-(2-Chlorophenyl)cyclopentanecarbonitrile - CAS 143328-15-8
Catalog: |
BB009554 |
Product Name: |
1-(2-Chlorophenyl)cyclopentanecarbonitrile |
CAS: |
143328-15-8 |
Synonyms: |
1-(2-chlorophenyl)-1-cyclopentanecarbonitrile; 1-(2-chlorophenyl)cyclopentane-1-carbonitrile |
IUPAC Name: | 1-(2-chlorophenyl)cyclopentane-1-carbonitrile |
Description: | 1-(2-Chlorophenyl)cyclopentanecarbonitrile (CAS# 143328-15-8) is a useful research chemical compound. |
Molecular Weight: | 205.68 |
Molecular Formula: | C12H12ClN |
Canonical SMILES: | C1CCC(C1)(C#N)C2=CC=CC=C2Cl |
InChI: | InChI=1S/C12H12ClN/c13-11-6-2-1-5-10(11)12(9-14)7-3-4-8-12/h1-2,5-6H,3-4,7-8H2 |
InChI Key: | ZFUMRJIGCNUOFZ-UHFFFAOYSA-N |
LogP: | 3.67538 |
Publication Number | Title | Priority Date |
BG-62326-B1 | Tetrahydroisoquinoline compounds and their appliaction as therapuetical substances | 19911223 |
BG-98822-A | Tetrahydroisoquinoline compounds | 19911223 |
CA-2126308-A1 | Therapeutic agents | 19911223 |
CZ-153494-A3 | Tetrahydroisoquinoline derivatives, process of their preparation, their use as a medicament and pharmaceutical composition containing such derivatives | 19911223 |
CZ-282869-B6 | Tetrahydroisoquinoline derivatives, process of their preparation, their use as a medicament and pharmaceutical compositions containing such derivatives | 19911223 |
Complexity: | 246 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.0658271 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.0658271 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS