1-(2-Chloro-6-fluorophenyl)cyclopropanecarbonitrile - CAS 124276-45-5
Catalog: |
BB005851 |
Product Name: |
1-(2-Chloro-6-fluorophenyl)cyclopropanecarbonitrile |
CAS: |
124276-45-5 |
Synonyms: |
1-(2-chloro-6-fluorophenyl)-1-cyclopropanecarbonitrile; 1-(2-chloro-6-fluorophenyl)cyclopropane-1-carbonitrile |
IUPAC Name: | 1-(2-chloro-6-fluorophenyl)cyclopropane-1-carbonitrile |
Description: | 1-(2-Chloro-6-fluorophenyl)cyclopropanecarbonitrile (CAS# 124276-45-5 ) is a useful research chemical. |
Molecular Weight: | 195.62 |
Molecular Formula: | C10H7ClFN |
Canonical SMILES: | C1CC1(C#N)C2=C(C=CC=C2Cl)F |
InChI: | InChI=1S/C10H7ClFN/c11-7-2-1-3-8(12)9(7)10(6-13)4-5-10/h1-3H,4-5H2 |
InChI Key: | DMOHTRXTNDOCKQ-UHFFFAOYSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
US-2003114502-A1 | Substituted thiazoles and oxazoles as corticotropin releasing hormone ligands | 20010713 |
US-7276526-B2 | Substituted thiazoles and oxazoles as corticotropin releasing hormone ligands | 20010713 |
WO-03006015-A1 | Substituted thiazoles and oxazoles as corticotropin releasing hormone ligands | 20010713 |
US-4859232-A | Substituted-aryl cyclopropanecarbonitriles and derivatives thereof as herbicide antidotes | 19861205 |
Complexity: | 253 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.0251051 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.0251051 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS