1-(2-Aminomethyl)phenyl-4-methylpiperazine - CAS 655256-68-1
Catalog: |
BB032759 |
Product Name: |
1-(2-Aminomethyl)phenyl-4-methylpiperazine |
CAS: |
655256-68-1 |
Synonyms: |
[2-(4-methyl-1-piperazinyl)phenyl]methanamine; [2-(4-methylpiperazin-1-yl)phenyl]methanamine |
IUPAC Name: | [2-(4-methylpiperazin-1-yl)phenyl]methanamine |
Description: | 1-(2-Aminomethyl)phenyl-4-methylpiperazine (CAS# 655256-68-1) is a useful research chemical for organic synthesis and other chemical processes. |
Molecular Weight: | 205.30 |
Molecular Formula: | C12H19N3 |
Canonical SMILES: | CN1CCN(CC1)C2=CC=CC=C2CN |
InChI: | InChI=1S/C12H19N3/c1-14-6-8-15(9-7-14)12-5-3-2-4-11(12)10-13/h2-5H,6-10,13H2,1H3 |
InChI Key: | GRSJANZWLLXZFG-UHFFFAOYSA-N |
Boiling Point: | 337.6 ℃ at 760 mmHg |
Density: | 1.065 g/cm3 |
MDL: | MFCD04970994 |
LogP: | 1.60030 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P330, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
AU-2016342309-A1 | Ferroportin inhibitors | 20151023 |
AU-2016342310-A1 | Novel ferroportin inhibitors | 20151023 |
CA-3002418-A1 | Novel ferroportin inhibitors | 20151023 |
EP-3364967-A2 | Ferroportin inhibitors | 20151023 |
EP-3365339-A1 | Novel ferroportin inhibitors | 20151023 |
Complexity: | 187 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.157897619 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.157897619 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 32.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS