1-(2,6-Difluorophenyl)cyclobutanecarbonitrile - CAS 1260741-00-1
Catalog: |
BB006355 |
Product Name: |
1-(2,6-Difluorophenyl)cyclobutanecarbonitrile |
CAS: |
1260741-00-1 |
Synonyms: |
1-(2,6-difluorophenyl)-1-cyclobutanecarbonitrile; 1-(2,6-difluorophenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(2,6-difluorophenyl)cyclobutane-1-carbonitrile |
Description: | 1-(2,6-Difluorophenyl)cyclobutanecarbonitrile (CAS# 1260741-00-1 ) is a useful research chemical. |
Molecular Weight: | 193.19 |
Molecular Formula: | C11H9F2N |
Canonical SMILES: | C1CC(C1)(C#N)C2=C(C=CC=C2F)F |
InChI: | InChI=1S/C11H9F2N/c12-8-3-1-4-9(13)10(8)11(7-14)5-2-6-11/h1,3-4H,2,5-6H2 |
InChI Key: | RVWMRQGDXZRNJE-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 254 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 193.07030562 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.07030562 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
-
[875573-66-3]
Estra-1,3,5(10)-triene-3,17-diol,7-(9-bromononyl)-,17-acetate,(7a,17b)-
-
[852913-16-7]
N-[3,5-Bis(trifluoromethyl)phenyl]-N-[(8a,9S)-6-methoxy-9-cinchonanyl]thiourea
-
[597-35-3]
ethylsulfone
-
[78697-25-3]
(p-Benzoylbenzyl)trimethylammonium chloride
-
[104517-96-6]
Ioversol related compound B
-
[2874-73-9]
2,2-dimethyldodecanoic Acid
INDUSTRY LEADERS TRUST OUR PRODUCTS