1-(2,6-Dichlorophenyl)cyclobutanamine Hydrochloride - CAS 1803598-02-8
Catalog: |
BB013681 |
Product Name: |
1-(2,6-Dichlorophenyl)cyclobutanamine Hydrochloride |
CAS: |
1803598-02-8 |
Synonyms: |
1-(2,6-dichlorophenyl)-1-cyclobutanamine;hydrochloride; 1-(2,6-dichlorophenyl)cyclobutan-1-amine;hydrochloride |
IUPAC Name: | 1-(2,6-dichlorophenyl)cyclobutan-1-amine;hydrochloride |
Description: | 1-(2,6-Dichlorophenyl)cyclobutanamine Hydrochloride (CAS# 1803598-02-8) is a useful research chemical. |
Molecular Weight: | 252.57 |
Molecular Formula: | C10H12Cl3N |
Canonical SMILES: | C1CC(C1)(C2=C(C=CC=C2Cl)Cl)N.Cl |
InChI: | InChI=1S/C10H11Cl2N.ClH/c11-7-3-1-4-8(12)9(7)10(13)5-2-6-10;/h1,3-4H,2,5-6,13H2;1H |
InChI Key: | UQSSKVAWCTVEAX-UHFFFAOYSA-N |
LogP: | 4.83360 |
Publication Number | Title | Priority Date |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 251.003532 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 251.003532 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS