1-(2,5-Difluorophenyl)cyclobutanamine - CAS 1314766-08-9
Catalog: |
BB007405 |
Product Name: |
1-(2,5-Difluorophenyl)cyclobutanamine |
CAS: |
1314766-08-9 |
Synonyms: |
1-(2,5-difluorophenyl)-1-cyclobutanamine; 1-(2,5-difluorophenyl)cyclobutan-1-amine |
IUPAC Name: | 1-(2,5-difluorophenyl)cyclobutan-1-amine |
Description: | 1-(2,5-Difluorophenyl)cyclobutanamine (CAS# 1314766-08-9 ) is a useful research chemical. |
Molecular Weight: | 183.20 |
Molecular Formula: | C10H11F2N |
Canonical SMILES: | C1CC(C1)(C2=C(C=CC(=C2)F)F)N |
InChI: | InChI=1S/C10H11F2N/c11-7-2-3-9(12)8(6-7)10(13)4-1-5-10/h2-3,6H,1,4-5,13H2 |
InChI Key: | KIIUOMSYACKKHJ-UHFFFAOYSA-N |
LogP: | 3.00300 |
Publication Number | Title | Priority Date |
US-10494355-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
US-2018273495-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
WO-2017065473-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2009239555-A1 | Cyclobutyl sulfones as Notch sparing gamma secretase inhibitors | 20080423 |
Complexity: | 191 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 183.08595568 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 183.08595568 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS