[1,2,4]Triazolo[1,5-a]pyridine-8-carboxylic Acid - CAS 1234616-36-4
Catalog: |
BB005692 |
Product Name: |
[1,2,4]Triazolo[1,5-a]pyridine-8-carboxylic Acid |
CAS: |
1234616-36-4 |
Synonyms: |
[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid; [1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
IUPAC Name: | [1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
Description: | [1,2,4]Triazolo[1,5-a]pyridine-8-carboxylic Acid can be used to prepare modulators of ion channels for pain treatment. |
Molecular Weight: | 163.13 |
Molecular Formula: | C7H5N3O2 |
Canonical SMILES: | C1=CN2C(=NC=N2)C(=C1)C(=O)O |
InChI: | InChI=1S/C7H5N3O2/c11-7(12)5-2-1-3-10-6(5)8-4-9-10/h1-4H,(H,11,12) |
InChI Key: | PZNISMDFEGHAPD-UHFFFAOYSA-N |
Storage: | Sealed in dry, 2-8 °C |
MDL: | MFCD17015982 |
LogP: | 0.42750 |
Publication Number | Title | Priority Date |
AU-2017364725-A1 | Method for producing triazolopyridine compound | 20161125 |
AU-2017364725-B2 | Method for producing triazolopyridine compound | 20161125 |
CA-2753696-A1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
CN-102333777-A | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
CN-102333777-B | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
Complexity: | 197 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.038176411 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.038176411 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 67.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS