1-(2,4-Difluorophenyl)cyclopropylamine Hydrochloride - CAS 1186663-18-2
Catalog: |
BB004202 |
Product Name: |
1-(2,4-Difluorophenyl)cyclopropylamine Hydrochloride |
CAS: |
1186663-18-2 |
Synonyms: |
1-(2,4-difluorophenyl)-1-cyclopropanamine;hydrochloride; 1-(2,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
IUPAC Name: | 1-(2,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
Description: | 1-(2,4-Difluorophenyl)cyclopropylamine Hydrochloride (CAS# 1186663-18-2) is a useful research chemical. |
Molecular Weight: | 205.63 |
Molecular Formula: | C9H10ClF2N |
Canonical SMILES: | C1CC1(C2=C(C=C(C=C2)F)F)N.Cl |
InChI: | InChI=1S/C9H9F2N.ClH/c10-6-1-2-7(8(11)5-6)9(12)3-4-9;/h1-2,5H,3-4,12H2;1H |
InChI Key: | TYWIBZMFYNGWIX-UHFFFAOYSA-N |
Storage: | Inert atmosphere, Room Temperature |
LogP: | 0.83000 |
Publication Number | Title | Priority Date |
AU-2017371674-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
BR-112019011121-A2 | benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
CA-3042004-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
EP-3551626-A1 | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
JP-2019536810-A | Benzenesulfonamide compounds and their use as therapeutic agents | 20161209 |
Complexity: | 179 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.0469833 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.0469833 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS