1-(2,4-Difluorophenyl)cyclopentanamine - CAS 1340120-25-3
Catalog: |
BB007856 |
Product Name: |
1-(2,4-Difluorophenyl)cyclopentanamine |
CAS: |
1340120-25-3 |
Synonyms: |
1-(2,4-difluorophenyl)-1-cyclopentanamine; 1-(2,4-difluorophenyl)cyclopentan-1-amine |
IUPAC Name: | 1-(2,4-difluorophenyl)cyclopentan-1-amine |
Description: | 1-(2,4-Difluorophenyl)cyclopentanamine (CAS# 1340120-25-3 ) is a useful research chemical. |
Molecular Weight: | 197.22 |
Molecular Formula: | C11H13F2N |
Canonical SMILES: | C1CCC(C1)(C2=C(C=C(C=C2)F)F)N |
InChI: | InChI=1S/C11H13F2N/c12-8-3-4-9(10(13)7-8)11(14)5-1-2-6-11/h3-4,7H,1-2,5-6,14H2 |
InChI Key: | OYAZOLKGTMSJIF-UHFFFAOYSA-N |
LogP: | 3.39310 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P330, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2016237057-A1 | Diarylalkylamine rev-erb antagonists and their use as medicaments | 20131009 |
US-2017136009-A1 | Diarylalkylamine rev-erb antagonists and their use as medicaments | 20131009 |
US-9611245-B2 | Diarylalkylamine REV-ERB antagonists and their use as medicaments | 20131009 |
US-9949968-B2 | Diarylalkylamine REV-ERB antagonists and their use as medicaments | 20131009 |
EP-2822954-B1 | Polycyclic-carbamoylpyridone compounds and their pharmaceutical use | 20121221 |
Complexity: | 202 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 197.10160574 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 197.10160574 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS