1-(2,3-Dichlorophenyl)cyclobutanecarbonitrile - CAS 1260653-34-6
Catalog: |
BB006311 |
Product Name: |
1-(2,3-Dichlorophenyl)cyclobutanecarbonitrile |
CAS: |
1260653-34-6 |
Synonyms: |
1-(2,3-dichlorophenyl)-1-cyclobutanecarbonitrile; 1-(2,3-dichlorophenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(2,3-dichlorophenyl)cyclobutane-1-carbonitrile |
Description: | 1-(2,3-Dichlorophenyl)cyclobutanecarbonitrile (CAS# 1260653-34-6 ) is a useful research chemical. |
Molecular Weight: | 226.10 |
Molecular Formula: | C11H9Cl2N |
Canonical SMILES: | C1CC(C1)(C#N)C2=C(C(=CC=C2)Cl)Cl |
InChI: | InChI=1S/C11H9Cl2N/c12-9-4-1-3-8(10(9)13)11(7-14)5-2-6-11/h1,3-4H,2,5-6H2 |
InChI Key: | MUPGUOJKERBECC-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
KR-101839137-B1 | Oxadiazole Amine Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20151012 |
Complexity: | 264 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.0112047 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.0112047 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS