1-(2,2-Diethylcyclopropyl)methanamine - CAS 802822-86-2
Catalog: |
BB036486 |
Product Name: |
1-(2,2-Diethylcyclopropyl)methanamine |
CAS: |
802822-86-2 |
Synonyms: |
(2,2-diethylcyclopropyl)methanamine |
IUPAC Name: | (2,2-diethylcyclopropyl)methanamine |
Description: | 1-(2,2-Diethylcyclopropyl)methanamine (CAS# 802822-86-2) is a useful research chemical. |
Molecular Weight: | 127.23 |
Molecular Formula: | C8H17N |
Canonical SMILES: | CCC1(CC1CN)CC |
InChI: | InChI=1S/C8H17N/c1-3-8(4-2)5-7(8)6-9/h7H,3-6,9H2,1-2H3 |
InChI Key: | ZNEANLRFEOLEAL-UHFFFAOYSA-N |
Boiling Point: | 130 ℃ at 760 mmHg |
Purity: | 95 % |
Density: | 0.839 g/cm3 |
MDL: | MFCD08691417 |
LogP: | 2.47170 |
Publication Number | Title | Priority Date |
EP-2867225-A1 | Pyrrolidine derivatives and their use as complement pathway modulators | 20120628 |
EP-2867225-B1 | Pyrrolidine derivatives and their use as complement pathway modulators | 20120628 |
US-2015190457-A1 | Pyrrolidine derivatives and their use as complement pathway modulators | 20120628 |
US-9468661-B2 | Pyrrolidine derivatives and their use as complement pathway modulators | 20120628 |
WO-2014002054-A1 | Pyrrolidine derivatives and their use as complement pathway modulators | 20120628 |
Complexity: | 94.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 127.136099547 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 127.136099547 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS