1-(1-Methyl-1H-pyrazol-4-yl)ethanone - CAS 37687-18-6
Catalog: |
BB023388 |
Product Name: |
1-(1-Methyl-1H-pyrazol-4-yl)ethanone |
CAS: |
37687-18-6 |
Synonyms: |
1-(1-methyl-4-pyrazolyl)ethanone; 1-(1-methylpyrazol-4-yl)ethanone |
IUPAC Name: | 1-(1-methylpyrazol-4-yl)ethanone |
Description: | 1-(1-Methyl-1H-pyrazol-4-yl)ethanone can be used as anticancer agents. |
Molecular Weight: | 124.14 |
Molecular Formula: | C6H8N2O |
Canonical SMILES: | CC(=O)C1=CN(N=C1)C |
InChI: | InChI=1S/C6H8N2O/c1-5(9)6-3-7-8(2)4-6/h3-4H,1-2H3 |
InChI Key: | PINVCRAZGLSROU-UHFFFAOYSA-N |
Boiling Point: | 221 ℃ at 760 mmHg |
Density: | 1.11 g/cm3 |
MDL: | MFCD00159640 |
LogP: | 0.62270 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021068953-A1 | Substituted tricyclic compound as prmt5 inhibitor and use thereof | 20191012 |
WO-2020207476-A1 | Pyrazolopyrazine derived compounds, pharmaceutical composition and use thereof | 20190412 |
WO-2020146858-A1 | Heteroaryl compounds as necrosis inhibitors, composition and method using the same | 20190111 |
CN-110294747-B | Isoxazoline derivatives and their use in agriculture | 20180323 |
CN-110914271-A | Bicyclic ketone compounds and methods of use thereof | 20170714 |
Complexity: | 124 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 124.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 124.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 34.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS