[1,1':3',1''-Terphenyl]-2'-carbaldehyde - CAS 169618-84-2
Catalog: |
BB012563 |
Product Name: |
[1,1':3',1''-Terphenyl]-2'-carbaldehyde |
CAS: |
169618-84-2 |
Synonyms: |
2,6-diphenylbenzaldehyde; 2,6-diphenylbenzaldehyde |
IUPAC Name: | 2,6-diphenylbenzaldehyde |
Description: | [1,1':3',1''-Terphenyl]-2'-carbaldehyde (CAS# 169618-84-2 ) is a useful research chemical. |
Molecular Weight: | 258.31 |
Molecular Formula: | C19H14O |
Canonical SMILES: | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)C=O |
InChI: | InChI=1S/C19H14O/c20-14-19-17(15-8-3-1-4-9-15)12-7-13-18(19)16-10-5-2-6-11-16/h1-14H |
InChI Key: | XVRQHBFFIFIFBS-UHFFFAOYSA-N |
LogP: | 4.83310 |
Publication Number | Title | Priority Date |
WO-2020217229-A1 | Polycyclic compound and an organic electroluminescence device comprising the polycyclic compound or the composition | 20190426 |
EP-2766348-A1 | Benzodioxepin-3-one compounds as dyes or as fluorescent emitters | 20111014 |
US-2014234238-A1 | Benzodioxepin-3-one compounds as dyes or as fluorescent emitters | 20111014 |
US-8907110-B2 | Benzodioxepin-3-one compounds as dyes or as fluorescent emitters | 20111014 |
WO-2013053422-A1 | Benzodioxepin-3-one compounds as dyes or as fluorescent emitters | 20111014 |
Complexity: | 273 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 258.104465066 |
Formal Charge: | 0 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 258.104465066 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS